About 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane
4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane (PubChem CID 166125540) has the molecular formula C17H27NO4
and a molecular weight of 309.41 g/mol. Its IUPAC name is 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane.
Molecular Properties
| Compound Name | 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane |
| PubChem CID | 166125540 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane |
| SMILES | CCOC.COc1cc2c(c(OCCCC=O)c1)CC(N)C2 |
| InChI | InChI=1S/C14H19NO3.C3H8O/c1-17-12-7-10-6-11(15)8-13(10)14(9-12)18-5-3-2-4-16;1-3-4-2/h4,7,9,11H,2-3,5-6,8,15H2,1H3;3H2,1-2H3 |
| InChIKey | ZMUREAYZCUYCMV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane?
The IUPAC name of 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane (CID 166125540) is 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane.
What is the SMILES notation for 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane?
The canonical SMILES for 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane is CCOC.COc1cc2c(c(OCCCC=O)c1)CC(N)C2.
What is the InChIKey of 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane?
The InChIKey is ZMUREAYZCUYCMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3.C3H8O/c1-17-12-7-10-6-11(15)8-13(10)14(9-12)18-5-3-2-4-16;1-3-4-2/h4,7,9,11H,2-3,5-6,8,15H2,1H3;3H2,1-2H3.
What are the key properties of 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane?
4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane has a molecular weight of 309.41 g/mol, XLogP of 2.13, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-amino-6-methoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanal;methoxyethane is sourced from PubChem (CID 166125540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).