C17H25NO4 — CID 166125629
ethyl 4-[(2-amino-6-ethoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanoate (PubChem CID 166125629) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is ethyl 4-[(2-amino-6-ethoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanoate.
| Compound Name | ethyl 4-[(2-amino-6-ethoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanoate |
|---|---|
| PubChem CID | 166125629 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | ethyl 4-[(2-amino-6-ethoxy-2,3-dihydro-1H-inden-4-yl)oxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cc(OCC)cc2c1CC(N)C2 |
| InChI | InChI=1S/C17H25NO4/c1-3-20-14-9-12-8-13(18)10-15(12)16(11-14)22-7-5-6-17(19)21-4-2/h9,11,13H,3-8,10,18H2,1-2H3 |
| InChIKey | ZSGAMKWLTFQHOL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|