C16H23NO3 — CID 166125619
ethyl 5-(2-amino-5-hydroxy-2,3-dihydro-1H-inden-4-yl)pentanoate (PubChem CID 166125619) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is ethyl 5-(2-amino-5-hydroxy-2,3-dihydro-1H-inden-4-yl)pentanoate.
| Compound Name | ethyl 5-(2-amino-5-hydroxy-2,3-dihydro-1H-inden-4-yl)pentanoate |
|---|---|
| PubChem CID | 166125619 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethyl 5-(2-amino-5-hydroxy-2,3-dihydro-1H-inden-4-yl)pentanoate |
| SMILES | CCOC(=O)CCCCc1c(O)ccc2c1CC(N)C2 |
| InChI | InChI=1S/C16H23NO3/c1-2-20-16(19)6-4-3-5-13-14-10-12(17)9-11(14)7-8-15(13)18/h7-8,12,18H,2-6,9-10,17H2,1H3 |
| InChIKey | XXTDAHXDEOGPTO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|