C16H23NO3 — CID 166125748
ethyl 4-(2-amino-4-methoxy-2,3-dihydro-1H-inden-5-yl)butanoate (PubChem CID 166125748) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is ethyl 4-(2-amino-4-methoxy-2,3-dihydro-1H-inden-5-yl)butanoate.
| Compound Name | ethyl 4-(2-amino-4-methoxy-2,3-dihydro-1H-inden-5-yl)butanoate |
|---|---|
| PubChem CID | 166125748 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethyl 4-(2-amino-4-methoxy-2,3-dihydro-1H-inden-5-yl)butanoate |
| SMILES | CCOC(=O)CCCc1ccc2c(c1OC)CC(N)C2 |
| InChI | InChI=1S/C16H23NO3/c1-3-20-15(18)6-4-5-11-7-8-12-9-13(17)10-14(12)16(11)19-2/h7-8,13H,3-6,9-10,17H2,1-2H3 |
| InChIKey | PFWKGRGHHSPPLR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |