C18H28NO2P — CID 145213155
3-(3a-amino-5-ethoxy-1,2,3,4,9,9a-hexahydrocyclopenta[b]naphthalen-1-yl)-1-phosphanylpropan-1-ol (PubChem CID 145213155) has the molecular formula C18H28NO2P and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-(3a-amino-5-ethoxy-1,2,3,4,9,9a-hexahydrocyclopenta[b]naphthalen-1-yl)-1-phosphanylpropan-1-ol.
| Compound Name | 3-(3a-amino-5-ethoxy-1,2,3,4,9,9a-hexahydrocyclopenta[b]naphthalen-1-yl)-1-phosphanylpropan-1-ol |
|---|---|
| PubChem CID | 145213155 |
| Molecular Formula | C18H28NO2P |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 3-(3a-amino-5-ethoxy-1,2,3,4,9,9a-hexahydrocyclopenta[b]naphthalen-1-yl)-1-phosphanylpropan-1-ol |
| SMILES | CCOc1cccc2c1CC1(N)CCC(CCC(O)P)C1C2 |
| InChI | InChI=1S/C18H28NO2P/c1-2-21-16-5-3-4-13-10-15-12(6-7-17(20)22)8-9-18(15,19)11-14(13)16/h3-5,12,15,17,20H,2,6-11,19,22H2,1H3 |
| InChIKey | VGGNZPQQWZDNIR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|