C24H38O5 — CID 144642167
2-[[1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid;methanol (PubChem CID 144642167) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is 2-[[1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid;methanol.
| Compound Name | 2-[[1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid;methanol |
|---|---|
| PubChem CID | 144642167 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 2-[[1-(3-hydroxyoctyl)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid;methanol |
| SMILES | CCCCCC(O)CCC1CCC2Cc3c(cccc3OCC(=O)O)CC12.CO |
| InChI | InChI=1S/C23H34O4.CH4O/c1-2-3-4-7-19(24)12-11-16-9-10-18-14-21-17(13-20(16)18)6-5-8-22(21)27-15-23(25)26;1-2/h5-6,8,16,18-20,24H,2-4,7,9-15H2,1H3,(H,25,26);2H,1H3 |
| InChIKey | CQQNJVFBMYFZGD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|