C31H49N3O6 — CID 144530150
2-[[1-[3-[[1-(2-aminoethylamino)-2-methyl-1-oxopropan-2-yl]-methylcarbamoyl]oxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid (PubChem CID 144530150) has the molecular formula C31H49N3O6 and a molecular weight of 559.75 g/mol. Its IUPAC name is 2-[[1-[3-[[1-(2-aminoethylamino)-2-methyl-1-oxopropan-2-yl]-methylcarbamoyl]oxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid.
| Compound Name | 2-[[1-[3-[[1-(2-aminoethylamino)-2-methyl-1-oxopropan-2-yl]-methylcarbamoyl]oxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 144530150 |
| Molecular Formula | C31H49N3O6 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.36 |
| IUPAC Name | 2-[[1-[3-[[1-(2-aminoethylamino)-2-methyl-1-oxopropan-2-yl]-methylcarbamoyl]oxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
| SMILES | CCCCCC(CCC1CCC2Cc3c(cccc3OCC(=O)O)CC12)OC(=O)N(C)C(C)(C)C(=O)NCCN |
| InChI | InChI=1S/C31H49N3O6/c1-5-6-7-10-24(40-30(38)34(4)31(2,3)29(37)33-17-16-32)15-14-21-12-13-23-19-26-22(18-25(21)23)9-8-11-27(26)39-20-28(35)36/h8-9,11,21,23-25H,5-7,10,12-20,32H2,1-4H3,(H,33,37)(H,35,36) |
| InChIKey | FANMWQOFXUTGKG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|