C31H40O5 — CID 155445021
benzyl 3-[[(3aR,9aR)-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-2-oxopropanoate (PubChem CID 155445021) has the molecular formula C31H40O5 and a molecular weight of 492.66 g/mol. Its IUPAC name is benzyl 3-[[(3aR,9aR)-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-2-oxopropanoate.
| Compound Name | benzyl 3-[[(3aR,9aR)-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-2-oxopropanoate |
|---|---|
| PubChem CID | 155445021 |
| Molecular Formula | C31H40O5 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | benzyl 3-[[(3aR,9aR)-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-2-oxopropanoate |
| SMILES | CCCCC[C@H](O)CCC1CC[C@@H]2Cc3c(cccc3OCC(=O)C(=O)OCc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C31H40O5/c1-2-3-5-12-26(32)17-16-23-14-15-25-19-28-24(18-27(23)25)11-8-13-30(28)35-21-29(33)31(34)36-20-22-9-6-4-7-10-22/h4,6-11,13,23,25-27,32H,2-3,5,12,14-21H2,1H3/t23?,25-,26+,27-/m1/s1 |
| InChIKey | GKTIAOKZJUHLQG-AFXJVPFWSA-N |
| XLogP | 5.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|