C35H57N3O6S2 — CID 144530162
2-[[1-[3-[[1-[2-[[3-(disulfanyl)-2,2-dimethylpropyl]amino]ethylamino]-2-methyl-1-oxopropan-2-yl]carbamoyloxy]octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid (PubChem CID 144530162) has the molecular formula C35H57N3O6S2 and a molecular weight of 679.99 g/mol. Its IUPAC name is 2-[[1-[3-[[1-[2-[[3-(disulfanyl)-2,2-dimethylpropyl]amino]ethylamino]-2-methyl-1-oxopropan-2-yl]carbamoyloxy]octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid.
| Compound Name | 2-[[1-[3-[[1-[2-[[3-(disulfanyl)-2,2-dimethylpropyl]amino]ethylamino]-2-methyl-1-oxopropan-2-yl]carbamoyloxy]octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 144530162 |
| Molecular Formula | C35H57N3O6S2 |
| Molecular Weight | 679.99 g/mol |
| Exact Mass | 679.37 |
| IUPAC Name | 2-[[1-[3-[[1-[2-[[3-(disulfanyl)-2,2-dimethylpropyl]amino]ethylamino]-2-methyl-1-oxopropan-2-yl]carbamoyloxy]octyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]acetic acid |
| SMILES | CCCCCC(CCC1CCC2Cc3c(cccc3OCC(=O)O)CC12)OC(=O)NC(C)(C)C(=O)NCCNCC(C)(C)CSS |
| InChI | InChI=1S/C35H57N3O6S2/c1-6-7-8-11-27(44-33(42)38-35(4,5)32(41)37-18-17-36-22-34(2,3)23-46-45)16-15-24-13-14-26-20-29-25(19-28(24)26)10-9-12-30(29)43-21-31(39)40/h9-10,12,24,26-28,36,45H,6-8,11,13-23H2,1-5H3,(H,37,41)(H,38,42)(H,39,40) |
| InChIKey | WHBXOMCLNWEFOC-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.99 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|