C28H43F3O4 — CID 144668405
methanol;(1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl)oxy]acetate (PubChem CID 144668405) has the molecular formula C28H43F3O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is methanol;(1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl)oxy]acetate.
| Compound Name | methanol;(1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl)oxy]acetate |
|---|---|
| PubChem CID | 144668405 |
| Molecular Formula | C28H43F3O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | methanol;(1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(1-octyl-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl)oxy]acetate |
| SMILES | CCCCCCCCC1CCC2Cc3c(cccc3OCC(=O)OC(C)(C)C(F)(F)F)CC12.CO |
| InChI | InChI=1S/C27H39F3O3.CH4O/c1-4-5-6-7-8-9-11-19-14-15-21-17-23-20(16-22(19)21)12-10-13-24(23)32-18-25(31)33-26(2,3)27(28,29)30;1-2/h10,12-13,19,21-22H,4-9,11,14-18H2,1-3H3;2H,1H3 |
| InChIKey | WZBULGCKTMJMJV-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|