C15H22N2 — CID 79739069
4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-N-propylbut-3-en-1-amine (PubChem CID 79739069) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-N-propylbut-3-en-1-amine.
| Compound Name | 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 79739069 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-N-propylbut-3-en-1-amine |
| SMILES | CCCNCCC=CC1CCc2cccnc21 |
| InChI | InChI=1S/C15H22N2/c1-2-10-16-11-4-3-6-13-8-9-14-7-5-12-17-15(13)14/h3,5-7,12-13,16H,2,4,8-11H2,1H3 |
| InChIKey | OTRVAWLXHUOORM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|