C18H28N2 — CID 79738717
N-(2-methylpropyl)-4-(5,6,7,8-tetrahydroquinolin-8-yl)pent-3-en-1-amine (PubChem CID 79738717) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-(2-methylpropyl)-4-(5,6,7,8-tetrahydroquinolin-8-yl)pent-3-en-1-amine.
| Compound Name | N-(2-methylpropyl)-4-(5,6,7,8-tetrahydroquinolin-8-yl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 79738717 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-(2-methylpropyl)-4-(5,6,7,8-tetrahydroquinolin-8-yl)pent-3-en-1-amine |
| SMILES | CC(=CCCNCC(C)C)C1CCCc2cccnc21 |
| InChI | InChI=1S/C18H28N2/c1-14(2)13-19-11-5-7-15(3)17-10-4-8-16-9-6-12-20-18(16)17/h6-7,9,12,14,17,19H,4-5,8,10-11,13H2,1-3H3 |
| InChIKey | AEDFQQOTIYEOBK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|