C24H40N2OSi — CID 59176590
N-methyl-N-[5-tri(propan-2-yl)silyloxypent-1-ynyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 59176590) has the molecular formula C24H40N2OSi and a molecular weight of 400.68 g/mol. Its IUPAC name is N-methyl-N-[5-tri(propan-2-yl)silyloxypent-1-ynyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-methyl-N-[5-tri(propan-2-yl)silyloxypent-1-ynyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 59176590 |
| Molecular Formula | C24H40N2OSi |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | N-methyl-N-[5-tri(propan-2-yl)silyloxypent-1-ynyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | CC(C)[Si](OCCCC#CN(C)C1CCCc2cccnc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H40N2OSi/c1-19(2)28(20(3)4,21(5)6)27-18-10-8-9-17-26(7)23-15-11-13-22-14-12-16-25-24(22)23/h12,14,16,19-21,23H,8,10-11,13,15,18H2,1-7H3 |
| InChIKey | BXFIQUATCJRJFX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|