C17H25NO2 — CID 166139196
ethyl (2S,3R)-3-pentyl-1,2,3,4-tetrahydroquinoline-2-carboxylate (PubChem CID 166139196) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is ethyl (2S,3R)-3-pentyl-1,2,3,4-tetrahydroquinoline-2-carboxylate.
| Compound Name | ethyl (2S,3R)-3-pentyl-1,2,3,4-tetrahydroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 166139196 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | ethyl (2S,3R)-3-pentyl-1,2,3,4-tetrahydroquinoline-2-carboxylate |
| SMILES | CCCCC[C@@H]1Cc2ccccc2N[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C17H25NO2/c1-3-5-6-10-14-12-13-9-7-8-11-15(13)18-16(14)17(19)20-4-2/h7-9,11,14,16,18H,3-6,10,12H2,1-2H3/t14-,16+/m1/s1 |
| InChIKey | BRDLBKYTOMLXTD-ZBFHGGJFSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|