C9H13N3 — CID 91755653
1,2,3,4-tetrahydroquinolin-2-ylhydrazine (PubChem CID 91755653) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroquinolin-2-ylhydrazine.
| Compound Name | 1,2,3,4-tetrahydroquinolin-2-ylhydrazine |
|---|---|
| PubChem CID | 91755653 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1,2,3,4-tetrahydroquinolin-2-ylhydrazine |
| SMILES | NNC1CCc2ccccc2N1 |
| InChI | InChI=1S/C9H13N3/c10-12-9-6-5-7-3-1-2-4-8(7)11-9/h1-4,9,11-12H,5-6,10H2 |
| InChIKey | JMAYPPUVSCTUPB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|