C13H12N2OS — CID 57229761
(3S)-3-phenyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine (PubChem CID 57229761) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is (3S)-3-phenyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine.
| Compound Name | (3S)-3-phenyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine |
|---|---|
| PubChem CID | 57229761 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (3S)-3-phenyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine |
| SMILES | NC1=N[C@@H](c2ccccc2)COc2ccsc21 |
| InChI | InChI=1S/C13H12N2OS/c14-13-12-11(6-7-17-12)16-8-10(15-13)9-4-2-1-3-5-9/h1-7,10H,8H2,(H2,14,15)/t10-/m1/s1 |
| InChIKey | WORAMXFDYQUJHY-SNVBAGLBSA-N |
| XLogP | 2.59 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |