C26H25N3O2 — CID 129266025
N,N-bis[[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]aniline (PubChem CID 129266025) has the molecular formula C26H25N3O2 and a molecular weight of 411.50 g/mol. Its IUPAC name is N,N-bis[[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]aniline.
| Compound Name | N,N-bis[[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 129266025 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N,N-bis[[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]aniline |
| SMILES | c1ccc([C@@H]2COC(CN(CC3=N[C@H](c4ccccc4)CO3)c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C26H25N3O2/c1-4-10-20(11-5-1)23-18-30-25(27-23)16-29(22-14-8-3-9-15-22)17-26-28-24(19-31-26)21-12-6-2-7-13-21/h1-15,23-24H,16-19H2/t23-,24-/m0/s1 |
| InChIKey | IUVVDUIVQSJPEP-ZEQRLZLVSA-N |
| XLogP | 4.83 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |