About 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine
2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 68922865) has the molecular formula C11H12ClNO
and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine.
Molecular Properties
| Compound Name | 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine |
| PubChem CID | 68922865 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | ClCC1=NC(c2ccccc2)CCO1 |
| InChI | InChI=1S/C11H12ClNO/c12-8-11-13-10(6-7-14-11)9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | KCVQEDSAQXDEGT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine?
The IUPAC name of 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine (CID 68922865) is 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine.
What is the SMILES notation for 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine?
The canonical SMILES for 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine is ClCC1=NC(c2ccccc2)CCO1.
What is the InChIKey of 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine?
The InChIKey is KCVQEDSAQXDEGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO/c12-8-11-13-10(6-7-14-11)9-4-2-1-3-5-9/h1-5,10H,6-8H2.
What are the key properties of 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine?
2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine has a molecular weight of 209.68 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine is sourced from PubChem (CID 68922865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).