C9H11N3O2S — CID 71380893
(7-hydroxyimino-5,6-dihydro-4H-1-benzothiophen-4-yl)urea (PubChem CID 71380893) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is (7-hydroxyimino-5,6-dihydro-4H-1-benzothiophen-4-yl)urea.
| Compound Name | (7-hydroxyimino-5,6-dihydro-4H-1-benzothiophen-4-yl)urea |
|---|---|
| PubChem CID | 71380893 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (7-hydroxyimino-5,6-dihydro-4H-1-benzothiophen-4-yl)urea |
| SMILES | NC(=O)NC1CCC(=NO)c2sccc21 |
| InChI | InChI=1S/C9H11N3O2S/c10-9(13)11-6-1-2-7(12-14)8-5(6)3-4-15-8/h3-4,6,14H,1-2H2,(H3,10,11,13) |
| InChIKey | QYITXRWUDJNKGO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|