C9H10OS — CID 14502005
4,5-dihydro-1-benzothiophen-6-ylmethanol (PubChem CID 14502005) has the molecular formula C9H10OS and a molecular weight of 166.25 g/mol. Its IUPAC name is 4,5-dihydro-1-benzothiophen-6-ylmethanol.
| Compound Name | 4,5-dihydro-1-benzothiophen-6-ylmethanol |
|---|---|
| PubChem CID | 14502005 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 4,5-dihydro-1-benzothiophen-6-ylmethanol |
| SMILES | OCC1=Cc2sccc2CC1 |
| InChI | InChI=1S/C9H10OS/c10-6-7-1-2-8-3-4-11-9(8)5-7/h3-5,10H,1-2,6H2 |
| InChIKey | XILLHLUTJFSPFE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |