C8H10OS — CID 92977551
(4S)-4,5,6,7-tetrahydro-1-benzothiophen-4-ol (PubChem CID 92977551) has the molecular formula C8H10OS and a molecular weight of 154.23 g/mol. Its IUPAC name is (4S)-4,5,6,7-tetrahydro-1-benzothiophen-4-ol.
| Compound Name | (4S)-4,5,6,7-tetrahydro-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 92977551 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | (4S)-4,5,6,7-tetrahydro-1-benzothiophen-4-ol |
| SMILES | O[C@H]1CCCc2sccc21 |
| InChI | InChI=1S/C8H10OS/c9-7-2-1-3-8-6(7)4-5-10-8/h4-5,7,9H,1-3H2/t7-/m0/s1 |
| InChIKey | WNIWYCSFEZILAE-ZETCQYMHSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |