C9H13N3S — CID 94880942
2-[(4R)-4,5,6,7-tetrahydro-1-benzothiophen-4-yl]guanidine (PubChem CID 94880942) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 2-[(4R)-4,5,6,7-tetrahydro-1-benzothiophen-4-yl]guanidine.
| Compound Name | 2-[(4R)-4,5,6,7-tetrahydro-1-benzothiophen-4-yl]guanidine |
|---|---|
| PubChem CID | 94880942 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2-[(4R)-4,5,6,7-tetrahydro-1-benzothiophen-4-yl]guanidine |
| SMILES | NC(N)=N[C@@H]1CCCc2sccc21 |
| InChI | InChI=1S/C9H13N3S/c10-9(11)12-7-2-1-3-8-6(7)4-5-13-8/h4-5,7H,1-3H2,(H4,10,11,12)/t7-/m1/s1 |
| InChIKey | KPFNVNFYDBWOLP-SSDOTTSWSA-N |
| XLogP | 1.40 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|