C11H12OS — CID 105110985
1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)prop-2-en-1-one (PubChem CID 105110985) has the molecular formula C11H12OS and a molecular weight of 192.28 g/mol. Its IUPAC name is 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)prop-2-en-1-one.
| Compound Name | 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 105110985 |
| Molecular Formula | C11H12OS |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)C1CCCc2sccc21 |
| InChI | InChI=1S/C11H12OS/c1-2-10(12)8-4-3-5-11-9(8)6-7-13-11/h2,6-8H,1,3-5H2 |
| InChIKey | DXFLWISUMNSMCI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|