C16H19NOS — CID 62843709
1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 62843709) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 62843709 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | OC1CCCc2c1ccn2C1CCCc2sccc21 |
| InChI | InChI=1S/C16H19NOS/c18-15-5-1-3-13-11(15)7-9-17(13)14-4-2-6-16-12(14)8-10-19-16/h7-10,14-15,18H,1-6H2 |
| InChIKey | WJMDWBXZFLOPEL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |