C11H16NOS+ — CID 142063120
[1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)azetidin-3-yl]oxidanium (PubChem CID 142063120) has the molecular formula C11H16NOS+ and a molecular weight of 210.32 g/mol. Its IUPAC name is [1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)azetidin-3-yl]oxidanium.
| Compound Name | [1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)azetidin-3-yl]oxidanium |
|---|---|
| PubChem CID | 142063120 |
| Molecular Formula | C11H16NOS+ |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | [1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)azetidin-3-yl]oxidanium |
| SMILES | [OH2+]C1CN(C2CCCc3sccc32)C1 |
| InChI | InChI=1S/C11H15NOS/c13-8-6-12(7-8)10-2-1-3-11-9(10)4-5-14-11/h4-5,8,10,13H,1-3,6-7H2/p+1 |
| InChIKey | FOYXJAYWYVLPPS-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 26.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|