C16H18N2S — CID 62842813
2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,3-dihydroisoindol-5-amine (PubChem CID 62842813) has the molecular formula C16H18N2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,3-dihydroisoindol-5-amine.
| Compound Name | 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,3-dihydroisoindol-5-amine |
|---|---|
| PubChem CID | 62842813 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,3-dihydroisoindol-5-amine |
| SMILES | Nc1ccc2c(c1)CN(C1CCCc3sccc31)C2 |
| InChI | InChI=1S/C16H18N2S/c17-13-5-4-11-9-18(10-12(11)8-13)15-2-1-3-16-14(15)6-7-19-16/h4-8,15H,1-3,9-10,17H2 |
| InChIKey | RGOMGBSJFUZPGG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|