C9H13FN2 — CID 106884295
(2-fluoro-4,6-dimethylphenyl)methylhydrazine (PubChem CID 106884295) has the molecular formula C9H13FN2 and a molecular weight of 168.21 g/mol. Its IUPAC name is (2-fluoro-4,6-dimethylphenyl)methylhydrazine.
| Compound Name | (2-fluoro-4,6-dimethylphenyl)methylhydrazine |
|---|---|
| PubChem CID | 106884295 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | (2-fluoro-4,6-dimethylphenyl)methylhydrazine |
| SMILES | Cc1cc(C)c(CNN)c(F)c1 |
| InChI | InChI=1S/C9H13FN2/c1-6-3-7(2)8(5-12-11)9(10)4-6/h3-4,12H,5,11H2,1-2H3 |
| InChIKey | WDLVSEGOFKMKLK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|