C28H29ClFN3 — CID 178161094
8-(1-chloroethenyl)-7-methylnaphthalene-1,3-diamine;ethane;5-ethynyl-6-fluoro-4-methylnaphthalen-2-amine (PubChem CID 178161094) has the molecular formula C28H29ClFN3 and a molecular weight of 462.01 g/mol. Its IUPAC name is 8-(1-chloroethenyl)-7-methylnaphthalene-1,3-diamine;ethane;5-ethynyl-6-fluoro-4-methylnaphthalen-2-amine.
| Compound Name | 8-(1-chloroethenyl)-7-methylnaphthalene-1,3-diamine;ethane;5-ethynyl-6-fluoro-4-methylnaphthalen-2-amine |
|---|---|
| PubChem CID | 178161094 |
| Molecular Formula | C28H29ClFN3 |
| Molecular Weight | 462.01 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 8-(1-chloroethenyl)-7-methylnaphthalene-1,3-diamine;ethane;5-ethynyl-6-fluoro-4-methylnaphthalen-2-amine |
| SMILES | C#Cc1c(F)ccc2cc(N)cc(C)c12.C=C(Cl)c1c(C)ccc2cc(N)cc(N)c12.CC |
| InChI | InChI=1S/C13H13ClN2.C13H10FN.C2H6/c1-7-3-4-9-5-10(15)6-11(16)13(9)12(7)8(2)14;1-3-11-12(14)5-4-9-7-10(15)6-8(2)13(9)11;1-2/h3-6H,2,15-16H2,1H3;1,4-7H,15H2,2H3;1-2H3 |
| InChIKey | QLSZISYHHLZASA-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.01 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|