C15H14F2 — CID 176661121
ethane;1-ethynyl-2,5-difluoro-8-methylnaphthalene (PubChem CID 176661121) has the molecular formula C15H14F2 and a molecular weight of 232.27 g/mol. Its IUPAC name is ethane;1-ethynyl-2,5-difluoro-8-methylnaphthalene.
| Compound Name | ethane;1-ethynyl-2,5-difluoro-8-methylnaphthalene |
|---|---|
| PubChem CID | 176661121 |
| Molecular Formula | C15H14F2 |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | ethane;1-ethynyl-2,5-difluoro-8-methylnaphthalene |
| SMILES | C#Cc1c(F)ccc2c(F)ccc(C)c12.CC |
| InChI | InChI=1S/C13H8F2.C2H6/c1-3-9-11(14)7-5-10-12(15)6-4-8(2)13(9)10;1-2/h1,4-7H,2H3;1-2H3 |
| InChIKey | GWOFVITZJHWHRI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|