About ethane;1-ethynyl-2,5-difluoro-4-methylbenzene
ethane;1-ethynyl-2,5-difluoro-4-methylbenzene (PubChem CID 143826354) has the molecular formula C11H12F2
and a molecular weight of 182.21 g/mol. Its IUPAC name is ethane;1-ethynyl-2,5-difluoro-4-methylbenzene.
Molecular Properties
| Compound Name | ethane;1-ethynyl-2,5-difluoro-4-methylbenzene |
| PubChem CID | 143826354 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | ethane;1-ethynyl-2,5-difluoro-4-methylbenzene |
| SMILES | C#Cc1cc(F)c(C)cc1F.CC |
| InChI | InChI=1S/C9H6F2.C2H6/c1-3-7-5-8(10)6(2)4-9(7)11;1-2/h1,4-5H,2H3;1-2H3 |
| InChIKey | BVDCHBSEMCNUKB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethynyl-2,5-difluoro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethynyl-2,5-difluoro-4-methylbenzene?
The IUPAC name of ethane;1-ethynyl-2,5-difluoro-4-methylbenzene (CID 143826354) is ethane;1-ethynyl-2,5-difluoro-4-methylbenzene.
What is the SMILES notation for ethane;1-ethynyl-2,5-difluoro-4-methylbenzene?
The canonical SMILES for ethane;1-ethynyl-2,5-difluoro-4-methylbenzene is C#Cc1cc(F)c(C)cc1F.CC.
What is the InChIKey of ethane;1-ethynyl-2,5-difluoro-4-methylbenzene?
The InChIKey is BVDCHBSEMCNUKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2.C2H6/c1-3-7-5-8(10)6(2)4-9(7)11;1-2/h1,4-5H,2H3;1-2H3.
What are the key properties of ethane;1-ethynyl-2,5-difluoro-4-methylbenzene?
ethane;1-ethynyl-2,5-difluoro-4-methylbenzene has a molecular weight of 182.21 g/mol, XLogP of 3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethynyl-2,5-difluoro-4-methylbenzene is sourced from PubChem (CID 143826354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).