C11H10F2O — CID 176587054
1-ethynyl-2,5-difluoro-4-propoxybenzene (PubChem CID 176587054) has the molecular formula C11H10F2O and a molecular weight of 196.20 g/mol. Its IUPAC name is 1-ethynyl-2,5-difluoro-4-propoxybenzene.
| Compound Name | 1-ethynyl-2,5-difluoro-4-propoxybenzene |
|---|---|
| PubChem CID | 176587054 |
| Molecular Formula | C11H10F2O |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-ethynyl-2,5-difluoro-4-propoxybenzene |
| SMILES | C#Cc1cc(F)c(OCCC)cc1F |
| InChI | InChI=1S/C11H10F2O/c1-3-5-14-11-7-9(12)8(4-2)6-10(11)13/h2,6-7H,3,5H2,1H3 |
| InChIKey | VVNMPIUQDJIQKK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|