C10H12F2O2 — CID 164890870
(2,5-difluoro-4-propoxyphenyl)methanol (PubChem CID 164890870) has the molecular formula C10H12F2O2 and a molecular weight of 202.20 g/mol. Its IUPAC name is (2,5-difluoro-4-propoxyphenyl)methanol.
| Compound Name | (2,5-difluoro-4-propoxyphenyl)methanol |
|---|---|
| PubChem CID | 164890870 |
| Molecular Formula | C10H12F2O2 |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (2,5-difluoro-4-propoxyphenyl)methanol |
| SMILES | CCCOc1cc(F)c(CO)cc1F |
| InChI | InChI=1S/C10H12F2O2/c1-2-3-14-10-5-8(11)7(6-13)4-9(10)12/h4-5,13H,2-3,6H2,1H3 |
| InChIKey | JHRNXSFSEBJLHD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |