C13H9F2N — CID 176919371
5-ethynyl-3,6-difluoro-4-methylnaphthalen-2-amine (PubChem CID 176919371) has the molecular formula C13H9F2N and a molecular weight of 217.22 g/mol. Its IUPAC name is 5-ethynyl-3,6-difluoro-4-methylnaphthalen-2-amine.
| Compound Name | 5-ethynyl-3,6-difluoro-4-methylnaphthalen-2-amine |
|---|---|
| PubChem CID | 176919371 |
| Molecular Formula | C13H9F2N |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 5-ethynyl-3,6-difluoro-4-methylnaphthalen-2-amine |
| SMILES | C#Cc1c(F)ccc2cc(N)c(F)c(C)c12 |
| InChI | InChI=1S/C13H9F2N/c1-3-9-10(14)5-4-8-6-11(16)13(15)7(2)12(8)9/h1,4-6H,16H2,2H3 |
| InChIKey | UHDLTJKFEDKNLB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|