C21H27F2NO2 — CID 178101750
N,N-dimethylmethanamine;ethane;(5-ethynyl-6,8-difluoro-4-propan-2-ylnaphthalen-2-yl) formate (PubChem CID 178101750) has the molecular formula C21H27F2NO2 and a molecular weight of 363.45 g/mol. Its IUPAC name is N,N-dimethylmethanamine;ethane;(5-ethynyl-6,8-difluoro-4-propan-2-ylnaphthalen-2-yl) formate.
| Compound Name | N,N-dimethylmethanamine;ethane;(5-ethynyl-6,8-difluoro-4-propan-2-ylnaphthalen-2-yl) formate |
|---|---|
| PubChem CID | 178101750 |
| Molecular Formula | C21H27F2NO2 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N,N-dimethylmethanamine;ethane;(5-ethynyl-6,8-difluoro-4-propan-2-ylnaphthalen-2-yl) formate |
| SMILES | C#Cc1c(F)cc(F)c2cc(OC=O)cc(C(C)C)c12.CC.CN(C)C |
| InChI | InChI=1S/C16H12F2O2.C3H9N.C2H6/c1-4-11-14(17)7-15(18)13-6-10(20-8-19)5-12(9(2)3)16(11)13;1-4(2)3;1-2/h1,5-9H,2-3H3;1-3H3;1-2H3 |
| InChIKey | XQYLYYVMNOOHFD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|