C26H21F2N5O3 — CID 171064075
[4-[4-(3-amino-5-methylpiperidin-1-yl)-8-fluoro-2-oxo-1H-pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-yl] formate (PubChem CID 171064075) has the molecular formula C26H21F2N5O3 and a molecular weight of 489.48 g/mol. Its IUPAC name is [4-[4-(3-amino-5-methylpiperidin-1-yl)-8-fluoro-2-oxo-1H-pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-yl] formate.
| Compound Name | [4-[4-(3-amino-5-methylpiperidin-1-yl)-8-fluoro-2-oxo-1H-pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-yl] formate |
|---|---|
| PubChem CID | 171064075 |
| Molecular Formula | C26H21F2N5O3 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [4-[4-(3-amino-5-methylpiperidin-1-yl)-8-fluoro-2-oxo-1H-pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-yl] formate |
| SMILES | C#Cc1c(F)ccc2cc(OC=O)cc(-c3ncc4c(N5CC(C)CC(N)C5)nc(=O)[nH]c4c3F)c12 |
| InChI | InChI=1S/C26H21F2N5O3/c1-3-17-20(27)5-4-14-7-16(36-12-34)8-18(21(14)17)23-22(28)24-19(9-30-23)25(32-26(35)31-24)33-10-13(2)6-15(29)11-33/h1,4-5,7-9,12-13,15H,6,10-11,29H2,2H3,(H,31,32,35) |
| InChIKey | ZTYNDOKYQCFWOW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|