C32H32F2N6O3 — CID 170375325
(3R,5R)-5-amino-1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol (PubChem CID 170375325) has the molecular formula C32H32F2N6O3 and a molecular weight of 586.64 g/mol. Its IUPAC name is (3R,5R)-5-amino-1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol.
| Compound Name | (3R,5R)-5-amino-1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 170375325 |
| Molecular Formula | C32H32F2N6O3 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | (3R,5R)-5-amino-1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5C[C@H](N)C[C@@H](O)C5)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C32H32F2N6O3/c1-2-22-25(33)6-5-18-11-20(41)13-23(26(18)22)28-27(34)29-24(14-36-28)30(39-15-19(35)12-21(42)16-39)38-31(37-29)43-17-32-7-3-9-40(32)10-4-8-32/h1,5-6,11,13-14,19,21,41-42H,3-4,7-10,12,15-17,35H2/t19-,21-/m1/s1 |
| InChIKey | WZFMEEZXLVLNDD-TZIWHRDSSA-N |
| XLogP | 3.72 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|