C34H33F2N5O3 — CID 169184832
3-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-8-ol (PubChem CID 169184832) has the molecular formula C34H33F2N5O3 and a molecular weight of 597.67 g/mol. Its IUPAC name is 3-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-8-ol.
| Compound Name | 3-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-8-ol |
|---|---|
| PubChem CID | 169184832 |
| Molecular Formula | C34H33F2N5O3 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | 3-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3-azabicyclo[3.2.1]octan-8-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CC6CCC(C5)C6O)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C34H33F2N5O3/c1-2-23-26(35)8-7-19-13-22(42)14-24(27(19)23)29-28(36)30-25(15-37-29)32(40-16-20-5-6-21(17-40)31(20)43)39-33(38-30)44-18-34-9-3-11-41(34)12-4-10-34/h1,7-8,13-15,20-21,31,42-43H,3-6,9-12,16-18H2 |
| InChIKey | GALGDNZMXVQSOF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|