C34H32F3N5O2 — CID 169184850
5-ethynyl-6-fluoro-4-[8-fluoro-4-(8-fluoro-3-azabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 169184850) has the molecular formula C34H32F3N5O2 and a molecular weight of 599.66 g/mol. Its IUPAC name is 5-ethynyl-6-fluoro-4-[8-fluoro-4-(8-fluoro-3-azabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | 5-ethynyl-6-fluoro-4-[8-fluoro-4-(8-fluoro-3-azabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 169184850 |
| Molecular Formula | C34H32F3N5O2 |
| Molecular Weight | 599.66 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 5-ethynyl-6-fluoro-4-[8-fluoro-4-(8-fluoro-3-azabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CC6CCC(C5)C6F)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C34H32F3N5O2/c1-2-23-26(35)8-7-19-13-22(43)14-24(27(19)23)30-29(37)31-25(15-38-30)32(41-16-20-5-6-21(17-41)28(20)36)40-33(39-31)44-18-34-9-3-11-42(34)12-4-10-34/h1,7-8,13-15,20-21,28,43H,3-6,9-12,16-18H2 |
| InChIKey | PZXRNBPYGUQAMQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|