C36H38F2N6O2 — CID 177366541
5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 177366541) has the molecular formula C36H38F2N6O2 and a molecular weight of 624.74 g/mol. Its IUPAC name is 5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | 5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 177366541 |
| Molecular Formula | C36H38F2N6O2 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | 5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5C6CCC5CN(C(C)C)C6)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C36H38F2N6O2/c1-4-26-29(37)10-7-22-15-25(45)16-27(30(22)26)32-31(38)33-28(17-39-32)34(44-23-8-9-24(44)19-42(18-23)21(2)3)41-35(40-33)46-20-36-11-5-13-43(36)14-6-12-36/h1,7,10,15-17,21,23-24,45H,5-6,8-9,11-14,18-20H2,2-3H3 |
| InChIKey | MKAJPOBSYDIQTG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|