C35H39BF2N6O5 — CID 169184159
CID 169184159 (PubChem CID 169184159) has the molecular formula C35H39BF2N6O5 and a molecular weight of 672.54 g/mol.
| Compound Name | CID 169184159 |
|---|---|
| PubChem CID | 169184159 |
| Molecular Formula | C35H39BF2N6O5 |
| Molecular Weight | 672.54 g/mol |
| Exact Mass | 672.30 |
| IUPAC Name | — |
| SMILES | CC.[B]C(O)(O)OCC1CN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cc(O)cc5ccc(F)c(C#C)c45)ncc23)CCN1 |
| InChI | InChI=1S/C33H33BF2N6O5.C2H6/c1-2-22-25(35)6-5-19-13-21(43)14-23(26(19)22)28-27(36)29-24(15-38-28)30(41-12-9-37-20(16-41)17-47-33(34,44)45)40-31(39-29)46-18-32-7-3-10-42(32)11-4-8-32;1-2/h1,5-6,13-15,20,37,43-45H,3-4,7-12,16-18H2;1-2H3 |
| InChIKey | SYPXOXVGBPWOCC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 136.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|