C35H38B2F2N6O3 — CID 169184240
CID 169184240 (PubChem CID 169184240) has the molecular formula C35H38B2F2N6O3 and a molecular weight of 650.35 g/mol.
| Compound Name | CID 169184240 |
|---|---|
| PubChem CID | 169184240 |
| Molecular Formula | C35H38B2F2N6O3 |
| Molecular Weight | 650.35 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | — |
| SMILES | CC.[B]C([B])(Oc1nc(N2CCNC(COC)C2)c2cnc(-c3cc(O)cc4ccc(F)c(C#C)c34)c(F)c2n1)C12CCCN1CCC2 |
| InChI | InChI=1S/C33H32B2F2N6O3.C2H6/c1-3-22-25(36)7-6-19-14-21(44)15-23(26(19)22)28-27(37)29-24(16-39-28)30(42-13-10-38-20(17-42)18-45-2)41-31(40-29)46-33(34,35)32-8-4-11-43(32)12-5-9-32;1-2/h1,6-7,14-16,20,38,44H,4-5,8-13,17-18H2,2H3;1-2H3 |
| InChIKey | JVDYZJHEZFDTLV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|