C35H38F2N6O3 — CID 169184118
5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(4-hydroxybutyl)piperazin-1-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 169184118) has the molecular formula C35H38F2N6O3 and a molecular weight of 628.72 g/mol. Its IUPAC name is 5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(4-hydroxybutyl)piperazin-1-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | 5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(4-hydroxybutyl)piperazin-1-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 169184118 |
| Molecular Formula | C35H38F2N6O3 |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | 5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(4-hydroxybutyl)piperazin-1-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CCNC(CCCCO)C5)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C35H38F2N6O3/c1-2-25-28(36)9-8-22-17-24(45)18-26(29(22)25)31-30(37)32-27(19-39-31)33(42-15-12-38-23(20-42)7-3-4-16-44)41-34(40-32)46-21-35-10-5-13-43(35)14-6-11-35/h1,8-9,17-19,23,38,44-45H,3-7,10-16,20-21H2 |
| InChIKey | UHRCJSVPCNQNCE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|