C37H40F2N6O3 — CID 169183993
5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[1-(4-hydroxybutyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 169183993) has the molecular formula C37H40F2N6O3 and a molecular weight of 654.76 g/mol. Its IUPAC name is 5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[1-(4-hydroxybutyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | 5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[1-(4-hydroxybutyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 169183993 |
| Molecular Formula | C37H40F2N6O3 |
| Molecular Weight | 654.76 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | 5-ethynyl-6-fluoro-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[1-(4-hydroxybutyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CC6CCC(CCCCO)(C5)N6)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C37H40F2N6O3/c1-2-26-29(38)8-7-23-17-25(47)18-27(30(23)26)32-31(39)33-28(19-40-32)34(44-20-24-9-13-36(21-44,43-24)10-3-4-16-46)42-35(41-33)48-22-37-11-5-14-45(37)15-6-12-37/h1,7-8,17-19,24,43,46-47H,3-6,9-16,20-22H2 |
| InChIKey | RTEMNIXQRYIEBC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.76 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|