C39H45F2N7O3 — CID 171083901
7-[4-[3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoropyrido[4,3-d]pyrimidin-2-yl]oxypropyl]piperazin-1-yl]heptanal (PubChem CID 171083901) has the molecular formula C39H45F2N7O3 and a molecular weight of 697.83 g/mol. Its IUPAC name is 7-[4-[3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoropyrido[4,3-d]pyrimidin-2-yl]oxypropyl]piperazin-1-yl]heptanal.
| Compound Name | 7-[4-[3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoropyrido[4,3-d]pyrimidin-2-yl]oxypropyl]piperazin-1-yl]heptanal |
|---|---|
| PubChem CID | 171083901 |
| Molecular Formula | C39H45F2N7O3 |
| Molecular Weight | 697.83 g/mol |
| Exact Mass | 697.36 |
| IUPAC Name | 7-[4-[3-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoropyrido[4,3-d]pyrimidin-2-yl]oxypropyl]piperazin-1-yl]heptanal |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CC6CCC(C5)N6)nc(OCCCN5CCN(CCCCCCC=O)CC5)nc4c3F)c12 |
| InChI | InChI=1S/C39H45F2N7O3/c1-2-30-33(40)12-9-26-21-29(50)22-31(34(26)30)36-35(41)37-32(23-42-36)38(48-24-27-10-11-28(25-48)43-27)45-39(44-37)51-20-8-14-47-17-15-46(16-18-47)13-6-4-3-5-7-19-49/h1,9,12,19,21-23,27-28,43,50H,3-8,10-11,13-18,20,24-25H2 |
| InChIKey | CYGOXPIRZZYWEZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.83 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|