C39H46F2N6O2 — CID 169228879
4-[2-(1-decylpyrrolidin-3-yl)oxy-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoropyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 169228879) has the molecular formula C39H46F2N6O2 and a molecular weight of 668.83 g/mol. Its IUPAC name is 4-[2-(1-decylpyrrolidin-3-yl)oxy-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoropyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[2-(1-decylpyrrolidin-3-yl)oxy-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoropyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 169228879 |
| Molecular Formula | C39H46F2N6O2 |
| Molecular Weight | 668.83 g/mol |
| Exact Mass | 668.37 |
| IUPAC Name | 4-[2-(1-decylpyrrolidin-3-yl)oxy-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoropyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5CC6CCC(C5)N6)nc(OC5CCN(CCCCCCCCCC)C5)nc4c3F)c12 |
| InChI | InChI=1S/C39H46F2N6O2/c1-3-5-6-7-8-9-10-11-17-46-18-16-29(24-46)49-39-44-37-32(38(45-39)47-22-26-13-14-27(23-47)43-26)21-42-36(35(37)41)31-20-28(48)19-25-12-15-33(40)30(4-2)34(25)31/h2,12,15,19-21,26-27,29,43,48H,3,5-11,13-14,16-18,22-24H2,1H3 |
| InChIKey | FWUXPHULRITOEJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.83 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|