C21H37NO2 — CID 164890364
3-(7-aminoheptyl)-4,6-ditert-butylbenzene-1,2-diol (PubChem CID 164890364) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is 3-(7-aminoheptyl)-4,6-ditert-butylbenzene-1,2-diol.
| Compound Name | 3-(7-aminoheptyl)-4,6-ditert-butylbenzene-1,2-diol |
|---|---|
| PubChem CID | 164890364 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | 3-(7-aminoheptyl)-4,6-ditert-butylbenzene-1,2-diol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(CCCCCCCN)c(O)c1O |
| InChI | InChI=1S/C21H37NO2/c1-20(2,3)16-14-17(21(4,5)6)19(24)18(23)15(16)12-10-8-7-9-11-13-22/h14,23-24H,7-13,22H2,1-6H3 |
| InChIKey | IBKPBVYOWSWJIG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|