C42H68N2O4 — CID 175225482
N-(6-aminohexyl)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[4-(3,5-ditert-butyl-4-hydroxyphenyl)butanoyl]butanamide (PubChem CID 175225482) has the molecular formula C42H68N2O4 and a molecular weight of 665.02 g/mol. Its IUPAC name is N-(6-aminohexyl)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[4-(3,5-ditert-butyl-4-hydroxyphenyl)butanoyl]butanamide.
| Compound Name | N-(6-aminohexyl)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[4-(3,5-ditert-butyl-4-hydroxyphenyl)butanoyl]butanamide |
|---|---|
| PubChem CID | 175225482 |
| Molecular Formula | C42H68N2O4 |
| Molecular Weight | 665.02 g/mol |
| Exact Mass | 664.52 |
| IUPAC Name | N-(6-aminohexyl)-4-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[4-(3,5-ditert-butyl-4-hydroxyphenyl)butanoyl]butanamide |
| SMILES | CC(C)(C)c1cc(CCCC(=O)N(CCCCCCN)C(=O)CCCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C42H68N2O4/c1-39(2,3)31-25-29(26-32(37(31)47)40(4,5)6)19-17-21-35(45)44(24-16-14-13-15-23-43)36(46)22-18-20-30-27-33(41(7,8)9)38(48)34(28-30)42(10,11)12/h25-28,47-48H,13-24,43H2,1-12H3 |
| InChIKey | JCKUDBSYINABGI-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.02 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|