C32H58O — CID 57324525
3-butyl-2,6-ditert-butyl-4-(5-butyldecan-5-yl)phenol (PubChem CID 57324525) has the molecular formula C32H58O and a molecular weight of 458.82 g/mol. Its IUPAC name is 3-butyl-2,6-ditert-butyl-4-(5-butyldecan-5-yl)phenol.
| Compound Name | 3-butyl-2,6-ditert-butyl-4-(5-butyldecan-5-yl)phenol |
|---|---|
| PubChem CID | 57324525 |
| Molecular Formula | C32H58O |
| Molecular Weight | 458.82 g/mol |
| Exact Mass | 458.45 |
| IUPAC Name | 3-butyl-2,6-ditert-butyl-4-(5-butyldecan-5-yl)phenol |
| SMILES | CCCCCC(CCCC)(CCCC)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1CCCC |
| InChI | InChI=1S/C32H58O/c1-11-15-19-23-32(21-17-13-3,22-18-14-4)26-24-27(30(5,6)7)29(33)28(31(8,9)10)25(26)20-16-12-2/h24,33H,11-23H2,1-10H3 |
| InChIKey | KGWSTQGYCXVMIN-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.82 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|