C38H66NiO8P2 — CID 88782473
bis((2-butyl-3,5-ditert-butyl-4-hydroxyphenyl)methylphosphonic acid);nickel (PubChem CID 88782473) has the molecular formula C38H66NiO8P2 and a molecular weight of 771.58 g/mol. Its IUPAC name is bis((2-butyl-3,5-ditert-butyl-4-hydroxyphenyl)methylphosphonic acid);nickel.
| Compound Name | bis((2-butyl-3,5-ditert-butyl-4-hydroxyphenyl)methylphosphonic acid);nickel |
|---|---|
| PubChem CID | 88782473 |
| Molecular Formula | C38H66NiO8P2 |
| Molecular Weight | 771.58 g/mol |
| Exact Mass | 770.36 |
| IUPAC Name | bis((2-butyl-3,5-ditert-butyl-4-hydroxyphenyl)methylphosphonic acid);nickel |
| SMILES | CCCCc1c(CP(=O)(O)O)cc(C(C)(C)C)c(O)c1C(C)(C)C.CCCCc1c(CP(=O)(O)O)cc(C(C)(C)C)c(O)c1C(C)(C)C.[Ni] |
| InChI | InChI=1S/2C19H33O4P.Ni/c2*1-8-9-10-14-13(12-24(21,22)23)11-15(18(2,3)4)17(20)16(14)19(5,6)7;/h2*11,20H,8-10,12H2,1-7H3,(H2,21,22,23); |
| InChIKey | YZNOYDRBZKEORA-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.58 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|