C19H30O3S — CID 88752116
3-[3,5-ditert-butyl-4-hydroxy-2-(2-sulfanylethyl)phenyl]propanoic acid (PubChem CID 88752116) has the molecular formula C19H30O3S and a molecular weight of 338.51 g/mol. Its IUPAC name is 3-[3,5-ditert-butyl-4-hydroxy-2-(2-sulfanylethyl)phenyl]propanoic acid.
| Compound Name | 3-[3,5-ditert-butyl-4-hydroxy-2-(2-sulfanylethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 88752116 |
| Molecular Formula | C19H30O3S |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 3-[3,5-ditert-butyl-4-hydroxy-2-(2-sulfanylethyl)phenyl]propanoic acid |
| SMILES | CC(C)(C)c1cc(CCC(=O)O)c(CCS)c(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H30O3S/c1-18(2,3)14-11-12(7-8-15(20)21)13(9-10-23)16(17(14)22)19(4,5)6/h11,22-23H,7-10H2,1-6H3,(H,20,21) |
| InChIKey | VWVDYFFOFMWOGO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|